C17H18N2O3 — CID 58064212
ethyl 7-methyl-6-(2-oxoethyl)-4,5-dihydroimidazo[1,5-a]quinoline-3-carboxylate (PubChem CID 58064212) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 7-methyl-6-(2-oxoethyl)-4,5-dihydroimidazo[1,5-a]quinoline-3-carboxylate.
| Compound Name | ethyl 7-methyl-6-(2-oxoethyl)-4,5-dihydroimidazo[1,5-a]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 58064212 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | ethyl 7-methyl-6-(2-oxoethyl)-4,5-dihydroimidazo[1,5-a]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1CCc1c-2ccc(C)c1CC=O |
| InChI | InChI=1S/C17H18N2O3/c1-3-22-17(21)16-15-7-5-13-12(8-9-20)11(2)4-6-14(13)19(15)10-18-16/h4,6,9-10H,3,5,7-8H2,1-2H3 |
| InChIKey | CIHNWQGFAUBYGS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|