C14H26F6N4 — CID 56839108
(Z)-N,N'-bis[3-(2,2,2-trifluoroethylamino)propyl]but-2-ene-1,4-diamine (PubChem CID 56839108) has the molecular formula C14H26F6N4 and a molecular weight of 364.38 g/mol. Its IUPAC name is (Z)-N,N'-bis[3-(2,2,2-trifluoroethylamino)propyl]but-2-ene-1,4-diamine.
| Compound Name | (Z)-N,N'-bis[3-(2,2,2-trifluoroethylamino)propyl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 56839108 |
| Molecular Formula | C14H26F6N4 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (Z)-N,N'-bis[3-(2,2,2-trifluoroethylamino)propyl]but-2-ene-1,4-diamine |
| SMILES | FC(F)(F)CNCCCNC/C=C\CNCCCNCC(F)(F)F |
| InChI | InChI=1S/C14H26F6N4/c15-13(16,17)11-23-9-3-7-21-5-1-2-6-22-8-4-10-24-12-14(18,19)20/h1-2,21-24H,3-12H2/b2-1- |
| InChIKey | RPQCSDUXODSIPD-UPHRSURJSA-N |
| XLogP | 1.81 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|