C18H36N4 — CID 19956427
(E)-N,N'-bis[3-(cyclopropylmethylamino)propyl]but-2-ene-1,4-diamine (PubChem CID 19956427) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is (E)-N,N'-bis[3-(cyclopropylmethylamino)propyl]but-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-bis[3-(cyclopropylmethylamino)propyl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 19956427 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | (E)-N,N'-bis[3-(cyclopropylmethylamino)propyl]but-2-ene-1,4-diamine |
| SMILES | C(=C/CNCCCNCC1CC1)\CNCCCNCC1CC1 |
| InChI | InChI=1S/C18H36N4/c1(9-19-11-3-13-21-15-17-5-6-17)2-10-20-12-4-14-22-16-18-7-8-18/h1-2,17-22H,3-16H2/b2-1+ |
| InChIKey | VUBOHDSQNSODEB-OWOJBTEDSA-N |
| XLogP | 1.50 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|