C18H37N3 — CID 70964455
N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-(cyclohexylmethyl)propane-1,3-diamine (PubChem CID 70964455) has the molecular formula C18H37N3 and a molecular weight of 295.51 g/mol. Its IUPAC name is N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-(cyclohexylmethyl)propane-1,3-diamine.
| Compound Name | N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-(cyclohexylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 70964455 |
| Molecular Formula | C18H37N3 |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.30 |
| IUPAC Name | N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-(cyclohexylmethyl)propane-1,3-diamine |
| SMILES | NCC1CCC(CNCCCNCC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H37N3/c19-13-16-7-9-18(10-8-16)15-21-12-4-11-20-14-17-5-2-1-3-6-17/h16-18,20-21H,1-15,19H2 |
| InChIKey | HQCYPSIYIQJIGO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|