C12H27N3 — CID 143996917
N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 143996917) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143996917 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N'-[[4-(aminomethyl)cyclohexyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCC1CCC(CN)CC1 |
| InChI | InChI=1S/C12H27N3/c1-14-7-2-8-15-10-12-5-3-11(9-13)4-6-12/h11-12,14-15H,2-10,13H2,1H3 |
| InChIKey | USRCHXIHSVVKSL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|