C19H49N3 — CID 143882693
N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen (PubChem CID 143882693) has the molecular formula C19H49N3 and a molecular weight of 319.62 g/mol. Its IUPAC name is N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen.
| Compound Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 143882693 |
| Molecular Formula | C19H49N3 |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 319.39 |
| IUPAC Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen |
| SMILES | CC.CCCC(CC)NCCCNCC1CCC(CN)CC1.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C17H37N3.C2H6.3H2/c1-3-6-17(4-2)20-12-5-11-19-14-16-9-7-15(13-18)8-10-16;1-2;;;/h15-17,19-20H,3-14,18H2,1-2H3;1-2H3;3*1H |
| InChIKey | BVDAOZOQDMPNHM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|