About N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen
N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen (PubChem CID 143882693) has the molecular formula C19H49N3
and a molecular weight of 319.62 g/mol. Its IUPAC name is N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen |
| PubChem CID | 143882693 |
| Molecular Formula | C19H49N3 |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 319.39 |
| IUPAC Name | N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen |
| SMILES | CC.CCCC(CC)NCCCNCC1CCC(CN)CC1.[H][H].[H][H].[H][H] |
| InChI | InChI=1S/C17H37N3.C2H6.3H2/c1-3-6-17(4-2)20-12-5-11-19-14-16-9-7-15(13-18)8-10-16;1-2;;;/h15-17,19-20H,3-14,18H2,1-2H3;1-2H3;3*1H |
| InChIKey | BVDAOZOQDMPNHM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen?
The IUPAC name of N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen (CID 143882693) is N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen.
What is the SMILES notation for N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen?
The canonical SMILES for N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen is CC.CCCC(CC)NCCCNCC1CCC(CN)CC1.[H][H].[H][H].[H][H].
What is the InChIKey of N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen?
The InChIKey is BVDAOZOQDMPNHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N3.C2H6.3H2/c1-3-6-17(4-2)20-12-5-11-19-14-16-9-7-15(13-18)8-10-16;1-2;;;/h15-17,19-20H,3-14,18H2,1-2H3;1-2H3;3*1H.
What are the key properties of N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen?
N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen has a molecular weight of 319.62 g/mol, XLogP of 4.66, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(aminomethyl)cyclohexyl]methyl]-N'-hexan-3-ylpropane-1,3-diamine;ethane;molecular hydrogen is sourced from PubChem (CID 143882693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).