C17H37N3 — CID 143882707
N-[2-(4-aminocyclohexyl)ethyl]-N'-hexan-3-ylpropane-1,3-diamine (PubChem CID 143882707) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is N-[2-(4-aminocyclohexyl)ethyl]-N'-hexan-3-ylpropane-1,3-diamine.
| Compound Name | N-[2-(4-aminocyclohexyl)ethyl]-N'-hexan-3-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143882707 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | N-[2-(4-aminocyclohexyl)ethyl]-N'-hexan-3-ylpropane-1,3-diamine |
| SMILES | CCCC(CC)NCCCNCCC1CCC(N)CC1 |
| InChI | InChI=1S/C17H37N3/c1-3-6-17(4-2)20-13-5-12-19-14-11-15-7-9-16(18)10-8-15/h15-17,19-20H,3-14,18H2,1-2H3 |
| InChIKey | HNNWJOGUCFTUIG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|