C11H24N2O2 — CID 175555316
N'-[(3,4-dimethoxycyclohexyl)methyl]ethane-1,2-diamine (PubChem CID 175555316) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is N'-[(3,4-dimethoxycyclohexyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(3,4-dimethoxycyclohexyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 175555316 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N'-[(3,4-dimethoxycyclohexyl)methyl]ethane-1,2-diamine |
| SMILES | COC1CCC(CNCCN)CC1OC |
| InChI | InChI=1S/C11H24N2O2/c1-14-10-4-3-9(7-11(10)15-2)8-13-6-5-12/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | CNUSVPGYQPVKDW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|