C24H46N4O — CID 140813056
N'-[[4-[3-[(4-methoxycyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl]cyclohexyl]methyl]ethane-1,2-diamine (PubChem CID 140813056) has the molecular formula C24H46N4O and a molecular weight of 406.66 g/mol. Its IUPAC name is N'-[[4-[3-[(4-methoxycyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl]cyclohexyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[4-[3-[(4-methoxycyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl]cyclohexyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 140813056 |
| Molecular Formula | C24H46N4O |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.37 |
| IUPAC Name | N'-[[4-[3-[(4-methoxycyclohexyl)methyl]-1,2,3a,4,5,6,7,7a-octahydrobenzimidazol-5-yl]cyclohexyl]methyl]ethane-1,2-diamine |
| SMILES | COC1CCC(CN2CNC3CCC(C4CCC(CNCCN)CC4)CC32)CC1 |
| InChI | InChI=1S/C24H46N4O/c1-29-22-9-4-19(5-10-22)16-28-17-27-23-11-8-21(14-24(23)28)20-6-2-18(3-7-20)15-26-13-12-25/h18-24,26-27H,2-17,25H2,1H3 |
| InChIKey | DROMTZZVOKKVAY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|