C21H37ClN4O2 — CID 163152826
methyl 3-[(4-chlorocyclohexyl)methyl]-5-(piperidin-3-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate (PubChem CID 163152826) has the molecular formula C21H37ClN4O2 and a molecular weight of 413.01 g/mol. Its IUPAC name is methyl 3-[(4-chlorocyclohexyl)methyl]-5-(piperidin-3-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate.
| Compound Name | methyl 3-[(4-chlorocyclohexyl)methyl]-5-(piperidin-3-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 163152826 |
| Molecular Formula | C21H37ClN4O2 |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | methyl 3-[(4-chlorocyclohexyl)methyl]-5-(piperidin-3-ylmethyl)-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridine-6-carboxylate |
| SMILES | COC(=O)C1CC2NCN(CC3CCC(Cl)CC3)C2CN1CC1CCCNC1 |
| InChI | InChI=1S/C21H37ClN4O2/c1-28-21(27)19-9-18-20(13-25(19)12-16-3-2-8-23-10-16)26(14-24-18)11-15-4-6-17(22)7-5-15/h15-20,23-24H,2-14H2,1H3 |
| InChIKey | ZTDQJTLORXUSOP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|