C29H27N3O4 — CID 56839306
3-[[1-[5-(naphthalene-2-carbonylamino)-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid (PubChem CID 56839306) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is 3-[[1-[5-(naphthalene-2-carbonylamino)-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid.
| Compound Name | 3-[[1-[5-(naphthalene-2-carbonylamino)-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 56839306 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-[[1-[5-(naphthalene-2-carbonylamino)-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCC2CCN(c3ccc(NC(=O)c4ccc5ccccc5c4)cn3)CC2)c1 |
| InChI | InChI=1S/C29H27N3O4/c33-28(23-9-8-21-4-1-2-5-22(21)16-23)31-25-10-11-27(30-18-25)32-14-12-20(13-15-32)19-36-26-7-3-6-24(17-26)29(34)35/h1-11,16-18,20H,12-15,19H2,(H,31,33)(H,34,35) |
| InChIKey | DUMFBZMVQSLDHV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |