C31H29N3O5 — CID 56839731
3-[[1-[5-[(4-phenoxybenzoyl)amino]-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid (PubChem CID 56839731) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is 3-[[1-[5-[(4-phenoxybenzoyl)amino]-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid.
| Compound Name | 3-[[1-[5-[(4-phenoxybenzoyl)amino]-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 56839731 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 3-[[1-[5-[(4-phenoxybenzoyl)amino]-2-pyridinyl]piperidin-4-yl]methoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCC2CCN(c3ccc(NC(=O)c4ccc(Oc5ccccc5)cc4)cn3)CC2)c1 |
| InChI | InChI=1S/C31H29N3O5/c35-30(23-9-12-27(13-10-23)39-26-6-2-1-3-7-26)33-25-11-14-29(32-20-25)34-17-15-22(16-18-34)21-38-28-8-4-5-24(19-28)31(36)37/h1-14,19-20,22H,15-18,21H2,(H,33,35)(H,36,37) |
| InChIKey | LXQZUWRDTHQEMT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |