C28H40O13 — CID 56843048
[2,2-bis(propanoyloxymethyl)-3-[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]propyl] propanoate (PubChem CID 56843048) has the molecular formula C28H40O13 and a molecular weight of 584.62 g/mol. Its IUPAC name is [2,2-bis(propanoyloxymethyl)-3-[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]propyl] propanoate.
| Compound Name | [2,2-bis(propanoyloxymethyl)-3-[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]propyl] propanoate |
|---|---|
| PubChem CID | 56843048 |
| Molecular Formula | C28H40O13 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [2,2-bis(propanoyloxymethyl)-3-[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]propyl] propanoate |
| SMILES | C=CC(=O)OCC(COCC(COC(=O)CC)(COC(=O)CC)COC(=O)CC)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C28H40O13/c1-7-21(29)36-15-27(16-37-22(30)8-2,17-38-23(31)9-3)13-35-14-28(18-39-24(32)10-4,19-40-25(33)11-5)20-41-26(34)12-6/h7-9H,1-3,10-20H2,4-6H3 |
| InChIKey | KYNPKSWIHZBHHN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|