C10H11N5NaO5PS — CID 56846238
sodium [(3aS,4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol (PubChem CID 56846238) has the molecular formula C10H11N5NaO5PS and a molecular weight of 367.26 g/mol. Its IUPAC name is sodium [(3aS,4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol.
| Compound Name | sodium [(3aS,4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol |
|---|---|
| PubChem CID | 56846238 |
| Molecular Formula | C10H11N5NaO5PS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | sodium [(3aS,4R,6R,6aS)-4-(6-aminopurin-9-yl)-2-oxido-2-sulfanylidene-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-6-yl]methanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H]2OP([O-])(=S)O[C@@H]21.[Na+] |
| InChI | InChI=1S/C10H12N5O5PS.Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7-6(4(1-16)18-10)19-21(17,22)20-7;/h2-4,6-7,10,16H,1H2,(H,17,22)(H2,11,12,13);/q;+1/p-1/t4-,6+,7+,10-,21?;/m1./s1 |
| InChIKey | PYTONXYLIVXPKO-VVNZVHIGSA-M |
| XLogP | -4.33 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|