C35H36N4O6 — CID 56850259
[4-[(4-methoxybenzoyl)amino]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]phenyl] 4-methoxybenzoate (PubChem CID 56850259) has the molecular formula C35H36N4O6 and a molecular weight of 608.70 g/mol. Its IUPAC name is [4-[(4-methoxybenzoyl)amino]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(4-methoxybenzoyl)amino]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 56850259 |
| Molecular Formula | C35H36N4O6 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | [4-[(4-methoxybenzoyl)amino]-3-[[4-(4-methyl-1,4-diazepan-1-yl)benzoyl]amino]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Nc2ccc(OC(=O)c3ccc(OC)cc3)cc2NC(=O)c2ccc(N3CCCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C35H36N4O6/c1-38-19-4-20-39(22-21-38)27-11-5-24(6-12-27)34(41)37-32-23-30(45-35(42)26-9-15-29(44-3)16-10-26)17-18-31(32)36-33(40)25-7-13-28(43-2)14-8-25/h5-18,23H,4,19-22H2,1-3H3,(H,36,40)(H,37,41) |
| InChIKey | SZQPOKKCRASQBR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|