C22H28BrNO4 — CID 56850620
methyl 2-[(1R,2S)-1-benzyl-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]acetate bromide (PubChem CID 56850620) has the molecular formula C22H28BrNO4 and a molecular weight of 450.37 g/mol. Its IUPAC name is methyl 2-[(1R,2S)-1-benzyl-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]acetate bromide.
| Compound Name | methyl 2-[(1R,2S)-1-benzyl-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]acetate bromide |
|---|---|
| PubChem CID | 56850620 |
| Molecular Formula | C22H28BrNO4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | methyl 2-[(1R,2S)-1-benzyl-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]acetate bromide |
| SMILES | COC(=O)C[N@+]1(C)CCc2cc(OC)c(OC)cc2[C@H]1Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C22H28NO4.BrH/c1-23(15-22(24)27-4)11-10-17-13-20(25-2)21(26-3)14-18(17)19(23)12-16-8-6-5-7-9-16;/h5-9,13-14,19H,10-12,15H2,1-4H3;1H/q+1;/p-1/t19-,23+;/m1./s1 |
| InChIKey | DZQQKJOOYQVZGA-GZAZMHIXSA-M |
| XLogP | 0.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|