C29H35N2O8P — CID 56851525
(10,20-diethyl-20-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaen-7-yl) dipropan-2-yl phosphate (PubChem CID 56851525) has the molecular formula C29H35N2O8P and a molecular weight of 570.58 g/mol. Its IUPAC name is (10,20-diethyl-20-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaen-7-yl) dipropan-2-yl phosphate.
| Compound Name | (10,20-diethyl-20-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaen-7-yl) dipropan-2-yl phosphate |
|---|---|
| PubChem CID | 56851525 |
| Molecular Formula | C29H35N2O8P |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | (10,20-diethyl-20-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.9.0.02,11.04,9.015,21]docosa-1(22),2,4(9),5,7,10,15(21)-heptaen-7-yl) dipropan-2-yl phosphate |
| SMILES | CCc1c2c(nc3ccc(OP(=O)(OC(C)C)OC(C)C)cc13)-c1cc3c(c(=O)n1C2)COC(=O)CC3(O)CC |
| InChI | InChI=1S/C29H35N2O8P/c1-7-19-20-11-18(39-40(35,37-16(3)4)38-17(5)6)9-10-24(20)30-27-21(19)14-31-25(27)12-23-22(28(31)33)15-36-26(32)13-29(23,34)8-2/h9-12,16-17,34H,7-8,13-15H2,1-6H3 |
| InChIKey | QVKMDOUKMIWGBV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|