C18H25N3O — CID 56852354
2-[1-(oxan-2-ylmethyl)piperidin-3-yl]-1H-benzimidazole (PubChem CID 56852354) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[1-(oxan-2-ylmethyl)piperidin-3-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(oxan-2-ylmethyl)piperidin-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 56852354 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-[1-(oxan-2-ylmethyl)piperidin-3-yl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(C3CCCN(CC4CCCCO4)C3)nc2c1 |
| InChI | InChI=1S/C18H25N3O/c1-2-9-17-16(8-1)19-18(20-17)14-6-5-10-21(12-14)13-15-7-3-4-11-22-15/h1-2,8-9,14-15H,3-7,10-13H2,(H,19,20) |
| InChIKey | RXVGRERLHAGWCA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |