C21H34N4O2 — CID 56853685
(3R,5S)-N-butyl-5-(morpholin-4-ylmethyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide (PubChem CID 56853685) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is (3R,5S)-N-butyl-5-(morpholin-4-ylmethyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-N-butyl-5-(morpholin-4-ylmethyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56853685 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (3R,5S)-N-butyl-5-(morpholin-4-ylmethyl)-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1C[C@H](CN2CCOCC2)CN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C21H34N4O2/c1-2-3-6-23-21(26)20-13-19(15-24-9-11-27-12-10-24)16-25(17-20)14-18-4-7-22-8-5-18/h4-5,7-8,19-20H,2-3,6,9-17H2,1H3,(H,23,26)/t19-,20-/m1/s1 |
| InChIKey | YFMCACADKHFEGQ-WOJBJXKFSA-N |
| XLogP | 1.77 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|