C24H39N3O3 — CID 56858639
(3R,5R)-N-butyl-1-[(3,4-dimethoxyphenyl)methyl]-5-(pyrrolidin-1-ylmethyl)piperidine-3-carboxamide (PubChem CID 56858639) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is (3R,5R)-N-butyl-1-[(3,4-dimethoxyphenyl)methyl]-5-(pyrrolidin-1-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R,5R)-N-butyl-1-[(3,4-dimethoxyphenyl)methyl]-5-(pyrrolidin-1-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56858639 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | (3R,5R)-N-butyl-1-[(3,4-dimethoxyphenyl)methyl]-5-(pyrrolidin-1-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1C[C@H](CN2CCCC2)CN(Cc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C24H39N3O3/c1-4-5-10-25-24(28)21-13-20(16-26-11-6-7-12-26)17-27(18-21)15-19-8-9-22(29-2)23(14-19)30-3/h8-9,14,20-21H,4-7,10-13,15-18H2,1-3H3,(H,25,28)/t20-,21-/m1/s1 |
| InChIKey | GLOYNHSUVXUKNO-NHCUHLMSSA-N |
| XLogP | 3.15 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|