C33H40N2O5 — CID 56857708
(3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-[(3,4-dimethoxyphenyl)methyl]-N-(2-phenoxyethyl)piperidine-3-carboxamide (PubChem CID 56857708) has the molecular formula C33H40N2O5 and a molecular weight of 544.69 g/mol. Its IUPAC name is (3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-[(3,4-dimethoxyphenyl)methyl]-N-(2-phenoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-[(3,4-dimethoxyphenyl)methyl]-N-(2-phenoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56857708 |
| Molecular Formula | C33H40N2O5 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | (3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-[(3,4-dimethoxyphenyl)methyl]-N-(2-phenoxyethyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(CN2C[C@@H](COc3ccc4c(c3)CCC4)C[C@@H](C(=O)NCCOc3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C33H40N2O5/c1-37-31-14-11-24(18-32(31)38-2)20-35-21-25(23-40-30-13-12-26-7-6-8-27(26)19-30)17-28(22-35)33(36)34-15-16-39-29-9-4-3-5-10-29/h3-5,9-14,18-19,25,28H,6-8,15-17,20-23H2,1-2H3,(H,34,36)/t25-,28+/m0/s1 |
| InChIKey | BGUAEPABCWEBEW-LBNVMWSVSA-N |
| XLogP | 4.90 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|