C35H38N2O3 — CID 56854833
(3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-(naphthalen-2-ylmethyl)-N-(2-phenoxyethyl)piperidine-3-carboxamide (PubChem CID 56854833) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is (3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-(naphthalen-2-ylmethyl)-N-(2-phenoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-(naphthalen-2-ylmethyl)-N-(2-phenoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56854833 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | (3R,5S)-5-(2,3-dihydro-1H-inden-5-yloxymethyl)-1-(naphthalen-2-ylmethyl)-N-(2-phenoxyethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)[C@@H]1C[C@H](COc2ccc3c(c2)CCC3)CN(Cc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C35H38N2O3/c38-35(36-17-18-39-33-11-2-1-3-12-33)32-20-27(25-40-34-16-15-29-9-6-10-31(29)21-34)23-37(24-32)22-26-13-14-28-7-4-5-8-30(28)19-26/h1-5,7-8,11-16,19,21,27,32H,6,9-10,17-18,20,22-25H2,(H,36,38)/t27-,32+/m0/s1 |
| InChIKey | AAHIPWBNJOZXFX-QVWWMRLHSA-N |
| XLogP | 6.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|