C26H35FN2O5 — CID 56859078
(3R,5S)-1-[(3,4-dimethoxyphenyl)methyl]-5-[(3-fluorophenoxy)methyl]-N-(3-methoxypropyl)piperidine-3-carboxamide (PubChem CID 56859078) has the molecular formula C26H35FN2O5 and a molecular weight of 474.57 g/mol. Its IUPAC name is (3R,5S)-1-[(3,4-dimethoxyphenyl)methyl]-5-[(3-fluorophenoxy)methyl]-N-(3-methoxypropyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-1-[(3,4-dimethoxyphenyl)methyl]-5-[(3-fluorophenoxy)methyl]-N-(3-methoxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56859078 |
| Molecular Formula | C26H35FN2O5 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (3R,5S)-1-[(3,4-dimethoxyphenyl)methyl]-5-[(3-fluorophenoxy)methyl]-N-(3-methoxypropyl)piperidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1C[C@H](COc2cccc(F)c2)CN(Cc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C26H35FN2O5/c1-31-11-5-10-28-26(30)21-12-20(18-34-23-7-4-6-22(27)14-23)16-29(17-21)15-19-8-9-24(32-2)25(13-19)33-3/h4,6-9,13-14,20-21H,5,10-12,15-18H2,1-3H3,(H,28,30)/t20-,21+/m0/s1 |
| InChIKey | OSNYIPXASJYZEM-LEWJYISDSA-N |
| XLogP | 3.51 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|