C16H22N4O2 — CID 56854000
(7S,9aR)-7-propan-2-yl-2-(pyridin-2-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56854000) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (7S,9aR)-7-propan-2-yl-2-(pyridin-2-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-propan-2-yl-2-(pyridin-2-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56854000 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (7S,9aR)-7-propan-2-yl-2-(pyridin-2-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H]2CN(Cc3ccccn3)CCN2C1=O |
| InChI | InChI=1S/C16H22N4O2/c1-11(2)14-16(22)20-8-7-19(10-13(20)15(21)18-14)9-12-5-3-4-6-17-12/h3-6,11,13-14H,7-10H2,1-2H3,(H,18,21)/t13-,14+/m1/s1 |
| InChIKey | NZJKJOCCWJTBMK-KGLIPLIRSA-N |
| XLogP | 0.25 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |