C21H33N5O3 — CID 135117823
cis-(2R,5R)-2-methyl-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione (PubChem CID 135117823) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is cis-(2R,5R)-2-methyl-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione.
| Compound Name | cis-(2R,5R)-2-methyl-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
|---|---|
| PubChem CID | 135117823 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | cis-(2R,5R)-2-methyl-5-propan-2-yl-11-(pyridin-2-ylmethyl)-1,4,7,11-tetrazacyclopentadecane-3,6,15-trione |
| SMILES | CC(C)[C@H]1NC(=O)[C@@H](C)NC(=O)CCCN(Cc2ccccn2)CCCNC1=O |
| InChI | InChI=1S/C21H33N5O3/c1-15(2)19-21(29)23-11-7-13-26(14-17-8-4-5-10-22-17)12-6-9-18(27)24-16(3)20(28)25-19/h4-5,8,10,15-16,19H,6-7,9,11-14H2,1-3H3,(H,23,29)(H,24,27)(H,25,28)/t16-,19-/m1/s1 |
| InChIKey | ARBBJOPRQWLRRZ-VQIMIIECSA-N |
| XLogP | 0.83 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |