C16H29N3O2 — CID 56854048
(7S,9aR)-7-[(2S)-butan-2-yl]-2-(3-methylbutyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56854048) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is (7S,9aR)-7-[(2S)-butan-2-yl]-2-(3-methylbutyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-[(2S)-butan-2-yl]-2-(3-methylbutyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56854048 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | (7S,9aR)-7-[(2S)-butan-2-yl]-2-(3-methylbutyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H]2CN(CCC(C)C)CCN2C1=O |
| InChI | InChI=1S/C16H29N3O2/c1-5-12(4)14-16(21)19-9-8-18(7-6-11(2)3)10-13(19)15(20)17-14/h11-14H,5-10H2,1-4H3,(H,17,20)/t12-,13+,14-/m0/s1 |
| InChIKey | WWGYJSAMPMSVRA-MJBXVCDLSA-N |
| XLogP | 1.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |