C15H29NO — CID 56854734
trans-(1R,2R)-2-[(6-methylhept-5-en-2-ylamino)methyl]cyclohexan-1-ol (PubChem CID 56854734) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(6-methylhept-5-en-2-ylamino)methyl]cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-[(6-methylhept-5-en-2-ylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 56854734 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | trans-(1R,2R)-2-[(6-methylhept-5-en-2-ylamino)methyl]cyclohexan-1-ol |
| SMILES | CC(C)=CCCC(C)NC[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C15H29NO/c1-12(2)7-6-8-13(3)16-11-14-9-4-5-10-15(14)17/h7,13-17H,4-6,8-11H2,1-3H3/t13?,14-,15-/m1/s1 |
| InChIKey | CFGUSOPSPICELP-JVIGXAJISA-N |
| XLogP | 3.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|