C18H24ClN3O4S — CID 56854774
(7S,9aR)-2-(4-chlorophenyl)sulfonyl-8-methyl-7-(2-methylpropyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56854774) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is (7S,9aR)-2-(4-chlorophenyl)sulfonyl-8-methyl-7-(2-methylpropyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-(4-chlorophenyl)sulfonyl-8-methyl-7-(2-methylpropyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56854774 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (7S,9aR)-2-(4-chlorophenyl)sulfonyl-8-methyl-7-(2-methylpropyl)-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC(C)C[C@H]1C(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)C[C@@H]2C(=O)N1C |
| InChI | InChI=1S/C18H24ClN3O4S/c1-12(2)10-15-18(24)22-9-8-21(11-16(22)17(23)20(15)3)27(25,26)14-6-4-13(19)5-7-14/h4-7,12,15-16H,8-11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | NZHWGXFHFONKNZ-JKSUJKDBSA-N |
| XLogP | 1.43 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |