C18H25N3O2 — CID 56855951
(7S,9aR)-2-[(2,4-dimethylphenyl)methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56855951) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (7S,9aR)-2-[(2,4-dimethylphenyl)methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-[(2,4-dimethylphenyl)methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56855951 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (7S,9aR)-2-[(2,4-dimethylphenyl)methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | Cc1ccc(CN2CCN3C(=O)[C@H](C)N(C)C(=O)[C@H]3C2)c(C)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-12-5-6-15(13(2)9-12)10-20-7-8-21-16(11-20)18(23)19(4)14(3)17(21)22/h5-6,9,14,16H,7-8,10-11H2,1-4H3/t14-,16+/m0/s1 |
| InChIKey | WRSDVOKCWRCXJS-GOEBONIOSA-N |
| XLogP | 1.18 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |