C30H32N2O3 — CID 56856201
1-[(4aR,8aR)-1-(4-phenylbenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-methoxyphenyl)ethanone (PubChem CID 56856201) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-[(4aR,8aR)-1-(4-phenylbenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-methoxyphenyl)ethanone.
| Compound Name | 1-[(4aR,8aR)-1-(4-phenylbenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 56856201 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 1-[(4aR,8aR)-1-(4-phenylbenzoyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)N1CC[C@@H]2[C@H](CCCN2C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C30H32N2O3/c1-35-28-12-6-5-10-25(28)20-29(33)31-19-17-27-26(21-31)11-7-18-32(27)30(34)24-15-13-23(14-16-24)22-8-3-2-4-9-22/h2-6,8-10,12-16,26-27H,7,11,17-21H2,1H3/t26-,27-/m1/s1 |
| InChIKey | NHWRJIJQJHECFC-KAYWLYCHSA-N |
| XLogP | 5.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |