C25H40N4O2 — CID 56857839
(3S,5R)-5-N-(2,3-dihydro-1H-inden-5-yl)-3-N-[3-(dimethylamino)propyl]-1-(2-methylpropyl)piperidine-3,5-dicarboxamide (PubChem CID 56857839) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is (3S,5R)-5-N-(2,3-dihydro-1H-inden-5-yl)-3-N-[3-(dimethylamino)propyl]-1-(2-methylpropyl)piperidine-3,5-dicarboxamide.
| Compound Name | (3S,5R)-5-N-(2,3-dihydro-1H-inden-5-yl)-3-N-[3-(dimethylamino)propyl]-1-(2-methylpropyl)piperidine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 56857839 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | (3S,5R)-5-N-(2,3-dihydro-1H-inden-5-yl)-3-N-[3-(dimethylamino)propyl]-1-(2-methylpropyl)piperidine-3,5-dicarboxamide |
| SMILES | CC(C)CN1C[C@@H](C(=O)NCCCN(C)C)C[C@@H](C(=O)Nc2ccc3c(c2)CCC3)C1 |
| InChI | InChI=1S/C25H40N4O2/c1-18(2)15-29-16-21(24(30)26-11-6-12-28(3)4)13-22(17-29)25(31)27-23-10-9-19-7-5-8-20(19)14-23/h9-10,14,18,21-22H,5-8,11-13,15-17H2,1-4H3,(H,26,30)(H,27,31)/t21-,22+/m0/s1 |
| InChIKey | XVNQERYRWQBAEI-FCHUYYIVSA-N |
| XLogP | 2.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|