C22H21Cl2N3O3 — CID 56858597
(7S,9aR)-7-benzyl-2-(3,5-dichlorobenzoyl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56858597) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is (7S,9aR)-7-benzyl-2-(3,5-dichlorobenzoyl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-benzyl-2-(3,5-dichlorobenzoyl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56858597 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (7S,9aR)-7-benzyl-2-(3,5-dichlorobenzoyl)-8-methyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CN1C(=O)[C@H]2CN(C(=O)c3cc(Cl)cc(Cl)c3)CCN2C(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-25-18(9-14-5-3-2-4-6-14)22(30)27-8-7-26(13-19(27)21(25)29)20(28)15-10-16(23)12-17(24)11-15/h2-6,10-12,18-19H,7-9,13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | ZDHOIUPUGWJZQV-RBUKOAKNSA-N |
| XLogP | 2.73 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |