C15H17N3O4S — CID 56860115
(3S,5R,9R)-5-hydroxy-11-(thiophene-2-carbonyl)-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione (PubChem CID 56860115) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is (3S,5R,9R)-5-hydroxy-11-(thiophene-2-carbonyl)-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione.
| Compound Name | (3S,5R,9R)-5-hydroxy-11-(thiophene-2-carbonyl)-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
|---|---|
| PubChem CID | 56860115 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (3S,5R,9R)-5-hydroxy-11-(thiophene-2-carbonyl)-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-2,8-dione |
| SMILES | O=C(c1cccs1)N1CCN2C(=O)[C@@H]3C[C@@H](O)CN3C(=O)[C@H]2C1 |
| InChI | InChI=1S/C15H17N3O4S/c19-9-6-10-13(20)17-4-3-16(15(22)12-2-1-5-23-12)8-11(17)14(21)18(10)7-9/h1-2,5,9-11,19H,3-4,6-8H2/t9-,10+,11-/m1/s1 |
| InChIKey | CKHVRFKLYNUTBP-OUAUKWLOSA-N |
| XLogP | -0.62 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |