C16H18N4O3S — CID 56860984
N-[(6-methoxy-1H-benzimidazol-2-yl)methylsulfamoyl]-1-phenylmethanamine (PubChem CID 56860984) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[(6-methoxy-1H-benzimidazol-2-yl)methylsulfamoyl]-1-phenylmethanamine.
| Compound Name | N-[(6-methoxy-1H-benzimidazol-2-yl)methylsulfamoyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 56860984 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[(6-methoxy-1H-benzimidazol-2-yl)methylsulfamoyl]-1-phenylmethanamine |
| SMILES | COc1ccc2nc(CNS(=O)(=O)NCc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C16H18N4O3S/c1-23-13-7-8-14-15(9-13)20-16(19-14)11-18-24(21,22)17-10-12-5-3-2-4-6-12/h2-9,17-18H,10-11H2,1H3,(H,19,20) |
| InChIKey | KVSUDXHJZFSJMI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |