C17H23N3O — CID 56861965
N-[(1R,3R)-3-aminocyclopentyl]-3,4,7-trimethyl-1H-indole-2-carboxamide (PubChem CID 56861965) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[(1R,3R)-3-aminocyclopentyl]-3,4,7-trimethyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1R,3R)-3-aminocyclopentyl]-3,4,7-trimethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 56861965 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[(1R,3R)-3-aminocyclopentyl]-3,4,7-trimethyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(C)c2c(C)c(C(=O)N[C@@H]3CC[C@@H](N)C3)[nH]c12 |
| InChI | InChI=1S/C17H23N3O/c1-9-4-5-10(2)15-14(9)11(3)16(20-15)17(21)19-13-7-6-12(18)8-13/h4-5,12-13,20H,6-8,18H2,1-3H3,(H,19,21)/t12-,13-/m1/s1 |
| InChIKey | LZEBUXAJFRNYRR-CHWSQXEVSA-N |
| XLogP | 2.70 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |