C21H24N4S — CID 56863611
4-[[4-[2-(4-methylsulfanylphenyl)imidazol-1-yl]piperidin-1-yl]methyl]pyridine (PubChem CID 56863611) has the molecular formula C21H24N4S and a molecular weight of 364.52 g/mol. Its IUPAC name is 4-[[4-[2-(4-methylsulfanylphenyl)imidazol-1-yl]piperidin-1-yl]methyl]pyridine.
| Compound Name | 4-[[4-[2-(4-methylsulfanylphenyl)imidazol-1-yl]piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 56863611 |
| Molecular Formula | C21H24N4S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[[4-[2-(4-methylsulfanylphenyl)imidazol-1-yl]piperidin-1-yl]methyl]pyridine |
| SMILES | CSc1ccc(-c2nccn2C2CCN(Cc3ccncc3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4S/c1-26-20-4-2-18(3-5-20)21-23-12-15-25(21)19-8-13-24(14-9-19)16-17-6-10-22-11-7-17/h2-7,10-12,15,19H,8-9,13-14,16H2,1H3 |
| InChIKey | FWODKLLEKSXYJC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |