C16H16N2O5S — CID 56863848
3-(cyclopropylsulfamoyl)-5-(6-methoxy-3-pyridinyl)benzoic acid (PubChem CID 56863848) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-5-(6-methoxy-3-pyridinyl)benzoic acid.
| Compound Name | 3-(cyclopropylsulfamoyl)-5-(6-methoxy-3-pyridinyl)benzoic acid |
|---|---|
| PubChem CID | 56863848 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-5-(6-methoxy-3-pyridinyl)benzoic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)cc(S(=O)(=O)NC3CC3)c2)cn1 |
| InChI | InChI=1S/C16H16N2O5S/c1-23-15-5-2-10(9-17-15)11-6-12(16(19)20)8-14(7-11)24(21,22)18-13-3-4-13/h2,5-9,13,18H,3-4H2,1H3,(H,19,20) |
| InChIKey | FNQVPPIRVVZFBQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |