C19H16N2O4S — CID 56881302
3-(cyclopropylsulfamoyl)-5-quinolin-8-ylbenzoic acid (PubChem CID 56881302) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-5-quinolin-8-ylbenzoic acid.
| Compound Name | 3-(cyclopropylsulfamoyl)-5-quinolin-8-ylbenzoic acid |
|---|---|
| PubChem CID | 56881302 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-5-quinolin-8-ylbenzoic acid |
| SMILES | O=C(O)c1cc(-c2cccc3cccnc23)cc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H16N2O4S/c22-19(23)14-9-13(10-16(11-14)26(24,25)21-15-6-7-15)17-5-1-3-12-4-2-8-20-18(12)17/h1-5,8-11,15,21H,6-7H2,(H,22,23) |
| InChIKey | ZURVJVLWWNSTGU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |