C10H8N2O4S — CID 50989782
8-sulfamoylquinoline-6-carboxylic acid (PubChem CID 50989782) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 8-sulfamoylquinoline-6-carboxylic acid.
| Compound Name | 8-sulfamoylquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 50989782 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 8-sulfamoylquinoline-6-carboxylic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc2cccnc12 |
| InChI | InChI=1S/C10H8N2O4S/c11-17(15,16)8-5-7(10(13)14)4-6-2-1-3-12-9(6)8/h1-5H,(H,13,14)(H2,11,15,16) |
| InChIKey | KFOWCJOEUUFESF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |