C14H16N2O5S — CID 167792756
8-(2-methoxypropylsulfonylamino)quinoline-6-carboxylic acid (PubChem CID 167792756) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is 8-(2-methoxypropylsulfonylamino)quinoline-6-carboxylic acid.
| Compound Name | 8-(2-methoxypropylsulfonylamino)quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 167792756 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 8-(2-methoxypropylsulfonylamino)quinoline-6-carboxylic acid |
| SMILES | COC(C)CS(=O)(=O)Nc1cc(C(=O)O)cc2cccnc12 |
| InChI | InChI=1S/C14H16N2O5S/c1-9(21-2)8-22(19,20)16-12-7-11(14(17)18)6-10-4-3-5-15-13(10)12/h3-7,9,16H,8H2,1-2H3,(H,17,18) |
| InChIKey | OIUFQODQTVHPSN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |