C21H26N6O — CID 56863882
[8-methyl-3-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylmethyl)imidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone (PubChem CID 56863882) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is [8-methyl-3-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylmethyl)imidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [8-methyl-3-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylmethyl)imidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 56863882 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [8-methyl-3-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-ylmethyl)imidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1cccn2c(CN3CCc4[nH]ncc4C3)c(C(=O)N3CCCCC3)nc12 |
| InChI | InChI=1S/C21H26N6O/c1-15-6-5-10-27-18(14-25-11-7-17-16(13-25)12-22-24-17)19(23-20(15)27)21(28)26-8-3-2-4-9-26/h5-6,10,12H,2-4,7-9,11,13-14H2,1H3,(H,22,24) |
| InChIKey | ICBOMEUAUYCGEQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |