C21H28N6O — CID 26395566
[3-[(3-imidazol-1-ylpropylamino)methyl]-8-methylimidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone (PubChem CID 26395566) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is [3-[(3-imidazol-1-ylpropylamino)methyl]-8-methylimidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-[(3-imidazol-1-ylpropylamino)methyl]-8-methylimidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 26395566 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [3-[(3-imidazol-1-ylpropylamino)methyl]-8-methylimidazo[1,2-a]pyridin-2-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1cccn2c(CNCCCn3ccnc3)c(C(=O)N3CCCCC3)nc12 |
| InChI | InChI=1S/C21H28N6O/c1-17-7-5-13-27-18(15-22-8-6-10-25-14-9-23-16-25)19(24-20(17)27)21(28)26-11-3-2-4-12-26/h5,7,9,13-14,16,22H,2-4,6,8,10-12,15H2,1H3 |
| InChIKey | HILLTQCXXZHJKQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|