C21H27ClN6O — CID 42591908
azocan-1-yl-[6-chloro-3-[(2-pyrazol-1-ylethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone (PubChem CID 42591908) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is azocan-1-yl-[6-chloro-3-[(2-pyrazol-1-ylethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone.
| Compound Name | azocan-1-yl-[6-chloro-3-[(2-pyrazol-1-ylethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 42591908 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | azocan-1-yl-[6-chloro-3-[(2-pyrazol-1-ylethylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone |
| SMILES | O=C(c1nc2ccc(Cl)cn2c1CNCCn1cccn1)N1CCCCCCC1 |
| InChI | InChI=1S/C21H27ClN6O/c22-17-7-8-19-25-20(21(29)26-11-4-2-1-3-5-12-26)18(28(19)16-17)15-23-10-14-27-13-6-9-24-27/h6-9,13,16,23H,1-5,10-12,14-15H2 |
| InChIKey | WEQRBEDFYMDPHX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|