C20H29ClN4OS — CID 42513954
azocan-1-yl-[6-chloro-3-[(3-methylsulfanylpropylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone (PubChem CID 42513954) has the molecular formula C20H29ClN4OS and a molecular weight of 409.00 g/mol. Its IUPAC name is azocan-1-yl-[6-chloro-3-[(3-methylsulfanylpropylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone.
| Compound Name | azocan-1-yl-[6-chloro-3-[(3-methylsulfanylpropylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone |
|---|---|
| PubChem CID | 42513954 |
| Molecular Formula | C20H29ClN4OS |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | azocan-1-yl-[6-chloro-3-[(3-methylsulfanylpropylamino)methyl]imidazo[1,2-a]pyridin-2-yl]methanone |
| SMILES | CSCCCNCc1c(C(=O)N2CCCCCCC2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C20H29ClN4OS/c1-27-13-7-10-22-14-17-19(23-18-9-8-16(21)15-25(17)18)20(26)24-11-5-3-2-4-6-12-24/h8-9,15,22H,2-7,10-14H2,1H3 |
| InChIKey | WXGVKYVKPYEINA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|