C14H22N2O2S — CID 56865181
3-[(2-cyclohexylimidazol-1-yl)methyl]thiolane 1,1-dioxide (PubChem CID 56865181) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-[(2-cyclohexylimidazol-1-yl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(2-cyclohexylimidazol-1-yl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 56865181 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[(2-cyclohexylimidazol-1-yl)methyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Cn2ccnc2C2CCCCC2)C1 |
| InChI | InChI=1S/C14H22N2O2S/c17-19(18)9-6-12(11-19)10-16-8-7-15-14(16)13-4-2-1-3-5-13/h7-8,12-13H,1-6,9-11H2 |
| InChIKey | WHQWQUZHCOWOIY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |