C13H21N3O2S — CID 106569453
N-cyclopentyl-1-[(1,1-dioxothiolan-3-yl)methyl]imidazol-2-amine (PubChem CID 106569453) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-cyclopentyl-1-[(1,1-dioxothiolan-3-yl)methyl]imidazol-2-amine.
| Compound Name | N-cyclopentyl-1-[(1,1-dioxothiolan-3-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106569453 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-cyclopentyl-1-[(1,1-dioxothiolan-3-yl)methyl]imidazol-2-amine |
| SMILES | O=S1(=O)CCC(Cn2ccnc2NC2CCCC2)C1 |
| InChI | InChI=1S/C13H21N3O2S/c17-19(18)8-5-11(10-19)9-16-7-6-14-13(16)15-12-3-1-2-4-12/h6-7,11-12H,1-5,8-10H2,(H,14,15) |
| InChIKey | RIYOJSZAQHOROD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |