C16H19ClN2O — CID 56865531
2-(4-chlorophenyl)-1-[2-(oxan-2-yl)ethyl]imidazole (PubChem CID 56865531) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[2-(oxan-2-yl)ethyl]imidazole.
| Compound Name | 2-(4-chlorophenyl)-1-[2-(oxan-2-yl)ethyl]imidazole |
|---|---|
| PubChem CID | 56865531 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[2-(oxan-2-yl)ethyl]imidazole |
| SMILES | Clc1ccc(-c2nccn2CCC2CCCCO2)cc1 |
| InChI | InChI=1S/C16H19ClN2O/c17-14-6-4-13(5-7-14)16-18-9-11-19(16)10-8-15-3-1-2-12-20-15/h4-7,9,11,15H,1-3,8,10,12H2 |
| InChIKey | IEUPUVNESXMFAK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |