C15H18ClN3O — CID 106002947
3-chloro-4-[2-(oxan-2-yl)ethyl]-5-phenyl-1,2,4-triazole (PubChem CID 106002947) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 3-chloro-4-[2-(oxan-2-yl)ethyl]-5-phenyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-[2-(oxan-2-yl)ethyl]-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 106002947 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-chloro-4-[2-(oxan-2-yl)ethyl]-5-phenyl-1,2,4-triazole |
| SMILES | Clc1nnc(-c2ccccc2)n1CCC1CCCCO1 |
| InChI | InChI=1S/C15H18ClN3O/c16-15-18-17-14(12-6-2-1-3-7-12)19(15)10-9-13-8-4-5-11-20-13/h1-3,6-7,13H,4-5,8-11H2 |
| InChIKey | LLVFVRDQFHTOHS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |