C17H27N3O3 — CID 56867805
1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylic acid (PubChem CID 56867805) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 56867805 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylic acid |
| SMILES | Cc1[nH]cnc1CN1CCC(CC2CCCCO2)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-13-15(19-12-18-13)11-20-7-5-17(6-8-20,16(21)22)10-14-4-2-3-9-23-14/h12,14H,2-11H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | ICXHZLDODXNUIX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |