C21H25ClN2O3 — CID 95557663
1-(8-chloroquinolin-2-yl)-4-[[(2R)-oxan-2-yl]methyl]piperidine-4-carboxylic acid (PubChem CID 95557663) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 1-(8-chloroquinolin-2-yl)-4-[[(2R)-oxan-2-yl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-(8-chloroquinolin-2-yl)-4-[[(2R)-oxan-2-yl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 95557663 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-(8-chloroquinolin-2-yl)-4-[[(2R)-oxan-2-yl]methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1(C[C@H]2CCCCO2)CCN(c2ccc3cccc(Cl)c3n2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3/c22-17-6-3-4-15-7-8-18(23-19(15)17)24-11-9-21(10-12-24,20(25)26)14-16-5-1-2-13-27-16/h3-4,6-8,16H,1-2,5,9-14H2,(H,25,26)/t16-/m1/s1 |
| InChIKey | VCHJKPQWUDDZTK-MRXNPFEDSA-N |
| XLogP | 4.52 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |